C27H25F3N4O3 — CID 22410075
3-[1-[3-(dimethylamino)-2-methoxypropyl]-4-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410075) has the molecular formula C27H25F3N4O3 and a molecular weight of 510.52 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)-2-methoxypropyl]-4-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)-2-methoxypropyl]-4-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410075 |
| Molecular Formula | C27H25F3N4O3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[1-[3-(dimethylamino)-2-methoxypropyl]-4-(trifluoromethyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COC(CN(C)C)Cn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C27H25F3N4O3/c1-33(2)12-15(37-3)13-34-14-18(22-19(27(28,29)30)8-6-10-21(22)34)24-23(25(35)32-26(24)36)17-11-31-20-9-5-4-7-16(17)20/h4-11,14-15,31H,12-13H2,1-3H3,(H,32,35,36) |
| InChIKey | RJWNGVJYGKIFEF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|