C30H32N4O5 — CID 22409242
3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409242) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409242 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-[1-(2-hydroxy-3-piperidin-1-ylpropyl)-4,5-dimethoxyindol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2c(c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)cn2CC(O)CN2CCCCC2)c1OC |
| InChI | InChI=1S/C30H32N4O5/c1-38-24-11-10-23-25(28(24)39-2)21(17-34(23)16-18(35)15-33-12-6-3-7-13-33)27-26(29(36)32-30(27)37)20-14-31-22-9-5-4-8-19(20)22/h4-5,8-11,14,17-18,31,35H,3,6-7,12-13,15-16H2,1-2H3,(H,32,36,37) |
| InChIKey | IVFLGDLGDMATLU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|