C24H20FN7O4 — CID 22409369
2-[3-[7-fluoro-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine (PubChem CID 22409369) has the molecular formula C24H20FN7O4 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[3-[7-fluoro-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine.
| Compound Name | 2-[3-[7-fluoro-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
|---|---|
| PubChem CID | 22409369 |
| Molecular Formula | C24H20FN7O4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[3-[7-fluoro-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl]-1-nitroguanidine |
| SMILES | N/C(=N\CCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2cccc(F)c21)N[N+](=O)[O-] |
| InChI | InChI=1S/C24H20FN7O4/c25-17-7-3-6-14-16(12-31(21(14)17)10-4-9-27-24(26)30-32(35)36)20-19(22(33)29-23(20)34)15-11-28-18-8-2-1-5-13(15)18/h1-3,5-8,11-12,28H,4,9-10H2,(H3,26,27,30)(H,29,33,34) |
| InChIKey | MQXVCJVFRKQWPR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|