C24H21N5O3S — CID 22409723
3-[4-hydroxy-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate (PubChem CID 22409723) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-[4-hydroxy-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate.
| Compound Name | 3-[4-hydroxy-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate |
|---|---|
| PubChem CID | 22409723 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-[4-hydroxy-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2c(O)cccc21 |
| InChI | InChI=1S/C24H21N5O3S/c25-24(26)33-10-4-9-29-12-15(19-17(29)7-3-8-18(19)30)21-20(22(31)28-23(21)32)14-11-27-16-6-2-1-5-13(14)16/h1-3,5-8,11-12,27,30H,4,9-10H2,(H3,25,26)(H,28,31,32) |
| InChIKey | KDUJPIZOYFTBFY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|