C24H20BrN5O2S — CID 22409561
3-[4-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate (PubChem CID 22409561) has the molecular formula C24H20BrN5O2S and a molecular weight of 522.43 g/mol. Its IUPAC name is 3-[4-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate.
| Compound Name | 3-[4-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate |
|---|---|
| PubChem CID | 22409561 |
| Molecular Formula | C24H20BrN5O2S |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 3-[4-bromo-3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2c(Br)cccc21 |
| InChI | InChI=1S/C24H20BrN5O2S/c25-16-6-3-8-18-19(16)15(12-30(18)9-4-10-33-24(26)27)21-20(22(31)29-23(21)32)14-11-28-17-7-2-1-5-13(14)17/h1-3,5-8,11-12,28H,4,9-10H2,(H3,26,27)(H,29,31,32) |
| InChIKey | AMGJWBLXOSYIMK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|