C31H27N5O3S — CID 22409414
3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4-phenylmethoxyindol-1-yl]propyl carbamimidothioate (PubChem CID 22409414) has the molecular formula C31H27N5O3S and a molecular weight of 549.66 g/mol. Its IUPAC name is 3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4-phenylmethoxyindol-1-yl]propyl carbamimidothioate.
| Compound Name | 3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4-phenylmethoxyindol-1-yl]propyl carbamimidothioate |
|---|---|
| PubChem CID | 22409414 |
| Molecular Formula | C31H27N5O3S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[3-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-4-phenylmethoxyindol-1-yl]propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCn1cc(C2=C(c3c[nH]c4ccccc34)C(=O)NC2=O)c2c(OCc3ccccc3)cccc21 |
| InChI | InChI=1S/C31H27N5O3S/c32-31(33)40-15-7-14-36-17-22(26-24(36)12-6-13-25(26)39-18-19-8-2-1-3-9-19)28-27(29(37)35-30(28)38)21-16-34-23-11-5-4-10-20(21)23/h1-6,8-13,16-17,34H,7,14-15,18H2,(H3,32,33)(H,35,37,38) |
| InChIKey | HBWIPSFJFITOIT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|