C28H27FN4O2 — CID 22410486
3-[6-fluoro-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22410486) has the molecular formula C28H27FN4O2 and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-[6-fluoro-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[6-fluoro-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410486 |
| Molecular Formula | C28H27FN4O2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 3-[6-fluoro-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN3CCCCC3)c3cc(F)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H27FN4O2/c29-18-9-10-20-22(17-33(24(20)15-18)14-6-13-32-11-4-1-5-12-32)26-25(27(34)31-28(26)35)21-16-30-23-8-3-2-7-19(21)23/h2-3,7-10,15-17,30H,1,4-6,11-14H2,(H,31,34,35) |
| InChIKey | DWEGQGVEUFMIFE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|