C29H28N4O4 — CID 22410061
3-(1H-indol-3-yl)-4-[8-(3-piperidin-1-ylpropyl)-[1,3]dioxolo[4,5-g]indol-6-yl]pyrrole-2,5-dione (PubChem CID 22410061) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[8-(3-piperidin-1-ylpropyl)-[1,3]dioxolo[4,5-g]indol-6-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[8-(3-piperidin-1-ylpropyl)-[1,3]dioxolo[4,5-g]indol-6-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410061 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[8-(3-piperidin-1-ylpropyl)-[1,3]dioxolo[4,5-g]indol-6-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN3CCCCC3)c3c4c(ccc23)OCO4)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H28N4O4/c34-28-24(20-15-30-22-8-3-2-7-18(20)22)25(29(35)31-28)21-16-33(14-6-13-32-11-4-1-5-12-32)26-19(21)9-10-23-27(26)37-17-36-23/h2-3,7-10,15-16,30H,1,4-6,11-14,17H2,(H,31,34,35) |
| InChIKey | GYQJWZDBXLEVKG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|