C28H28N4O3S — CID 22410424
3-(1H-indol-3-yl)-4-[5-methylsulfanyl-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 22410424) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[5-methylsulfanyl-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[5-methylsulfanyl-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410424 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[5-methylsulfanyl-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | CSc1ccc2c(c1)c(C1=C(c3c[nH]c4ccccc34)C(=O)NC1=O)cn2CCCN1CCOCC1 |
| InChI | InChI=1S/C28H28N4O3S/c1-36-18-7-8-24-20(15-18)22(17-32(24)10-4-9-31-11-13-35-14-12-31)26-25(27(33)30-28(26)34)21-16-29-23-6-3-2-5-19(21)23/h2-3,5-8,15-17,29H,4,9-14H2,1H3,(H,30,33,34) |
| InChIKey | OKNYOMTZWWWFHL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|