C30H31IN4O2S2 — CID 67768938
3-[2-iodo-5-methylsulfanyl-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-methylsulfanyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67768938) has the molecular formula C30H31IN4O2S2 and a molecular weight of 670.64 g/mol. Its IUPAC name is 3-[2-iodo-5-methylsulfanyl-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-methylsulfanyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-iodo-5-methylsulfanyl-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-methylsulfanyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67768938 |
| Molecular Formula | C30H31IN4O2S2 |
| Molecular Weight | 670.64 g/mol |
| Exact Mass | 670.09 |
| IUPAC Name | 3-[2-iodo-5-methylsulfanyl-1-(3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-methylsulfanyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CSc1ccc2[nH]cc(C3=C(c4c(I)n(CCCN5CCCCC5)c5ccc(SC)cc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C30H31IN4O2S2/c1-38-18-7-9-23-20(15-18)22(17-32-23)26-27(30(37)33-29(26)36)25-21-16-19(39-2)8-10-24(21)35(28(25)31)14-6-13-34-11-4-3-5-12-34/h7-10,15-17,32H,3-6,11-14H2,1-2H3,(H,33,36,37) |
| InChIKey | PHEUPXXCFURICU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|