C19H20N4O4 — CID 45381225
3,6-dinitro-9-(3-pyrrolidin-1-ylpropyl)carbazole (PubChem CID 45381225) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3,6-dinitro-9-(3-pyrrolidin-1-ylpropyl)carbazole.
| Compound Name | 3,6-dinitro-9-(3-pyrrolidin-1-ylpropyl)carbazole |
|---|---|
| PubChem CID | 45381225 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3,6-dinitro-9-(3-pyrrolidin-1-ylpropyl)carbazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c1cc([N+](=O)[O-])ccc1n2CCCN1CCCC1 |
| InChI | InChI=1S/C19H20N4O4/c24-22(25)14-4-6-18-16(12-14)17-13-15(23(26)27)5-7-19(17)21(18)11-3-10-20-8-1-2-9-20/h4-7,12-13H,1-3,8-11H2 |
| InChIKey | FLSMJZRHRGQDOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|