C39H36N4O5 — CID 67768522
3-[5-[3-(dimethylamino)-2-hydroxy-3-phenylmethoxypropyl]-1H-indol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67768522) has the molecular formula C39H36N4O5 and a molecular weight of 640.74 g/mol. Its IUPAC name is 3-[5-[3-(dimethylamino)-2-hydroxy-3-phenylmethoxypropyl]-1H-indol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-[3-(dimethylamino)-2-hydroxy-3-phenylmethoxypropyl]-1H-indol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67768522 |
| Molecular Formula | C39H36N4O5 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 3-[5-[3-(dimethylamino)-2-hydroxy-3-phenylmethoxypropyl]-1H-indol-3-yl]-4-(5-phenylmethoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)C(OCc1ccccc1)C(O)Cc1ccc2[nH]cc(C3=C(c4c[nH]c5ccc(OCc6ccccc6)cc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C39H36N4O5/c1-43(2)39(48-23-25-11-7-4-8-12-25)34(44)18-26-13-15-32-28(17-26)30(20-40-32)35-36(38(46)42-37(35)45)31-21-41-33-16-14-27(19-29(31)33)47-22-24-9-5-3-6-10-24/h3-17,19-21,34,39-41,44H,18,22-23H2,1-2H3,(H,42,45,46) |
| InChIKey | ZPLXGTJOMQIGOF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|