C25H22Cl2N4O3 — CID 67769294
3-[5-[3-chloro-3-(dimethylamino)-2-hydroxypropyl]-1H-indol-3-yl]-4-(5-chloro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 67769294) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 3-[5-[3-chloro-3-(dimethylamino)-2-hydroxypropyl]-1H-indol-3-yl]-4-(5-chloro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-[3-chloro-3-(dimethylamino)-2-hydroxypropyl]-1H-indol-3-yl]-4-(5-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67769294 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-[5-[3-chloro-3-(dimethylamino)-2-hydroxypropyl]-1H-indol-3-yl]-4-(5-chloro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)C(Cl)C(O)Cc1ccc2[nH]cc(C3=C(c4c[nH]c5ccc(Cl)cc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C25H22Cl2N4O3/c1-31(2)23(27)20(32)8-12-3-5-18-14(7-12)16(10-28-18)21-22(25(34)30-24(21)33)17-11-29-19-6-4-13(26)9-15(17)19/h3-7,9-11,20,23,28-29,32H,8H2,1-2H3,(H,30,33,34) |
| InChIKey | GUDOBTPMEXZWCN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|