C21H14ClN3O3 — CID 22308775
3-(6-chloro-1H-indol-3-yl)-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22308775) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is 3-(6-chloro-1H-indol-3-yl)-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(6-chloro-1H-indol-3-yl)-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22308775 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 3-(6-chloro-1H-indol-3-yl)-4-(5-methoxy-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(c4c[nH]c5cc(Cl)ccc45)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C21H14ClN3O3/c1-28-11-3-5-16-13(7-11)15(9-23-16)19-18(20(26)25-21(19)27)14-8-24-17-6-10(22)2-4-12(14)17/h2-9,23-24H,1H3,(H,25,26,27) |
| InChIKey | NGXOSGKKRLWBSO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|