C13H8ClNO3 — CID 126480665
3-chloro-4-(5-methoxy-1H-indol-3-yl)cyclobut-3-ene-1,2-dione (PubChem CID 126480665) has the molecular formula C13H8ClNO3 and a molecular weight of 261.66 g/mol. Its IUPAC name is 3-chloro-4-(5-methoxy-1H-indol-3-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-chloro-4-(5-methoxy-1H-indol-3-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 126480665 |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 3-chloro-4-(5-methoxy-1H-indol-3-yl)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc2[nH]cc(-c3c(Cl)c(=O)c3=O)c2c1 |
| InChI | InChI=1S/C13H8ClNO3/c1-18-6-2-3-9-7(4-6)8(5-15-9)10-11(14)13(17)12(10)16/h2-5,15H,1H3 |
| InChIKey | DCMHVXPGJHANAN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|