C18H17NO6S — CID 22425109
3-(3,4-dimethoxyphenyl)sulfonyl-6-methoxy-1H-quinolin-4-one (PubChem CID 22425109) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)sulfonyl-6-methoxy-1H-quinolin-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)sulfonyl-6-methoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 22425109 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)sulfonyl-6-methoxy-1H-quinolin-4-one |
| SMILES | COc1ccc2[nH]cc(S(=O)(=O)c3ccc(OC)c(OC)c3)c(=O)c2c1 |
| InChI | InChI=1S/C18H17NO6S/c1-23-11-4-6-14-13(8-11)18(20)17(10-19-14)26(21,22)12-5-7-15(24-2)16(9-12)25-3/h4-10H,1-3H3,(H,19,20) |
| InChIKey | AGCVVCXGSXOYQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |