C17H14FNO3S — CID 22425158
3-(3-fluoro-4-methylphenyl)sulfonyl-6-methyl-1H-quinolin-4-one (PubChem CID 22425158) has the molecular formula C17H14FNO3S and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)sulfonyl-6-methyl-1H-quinolin-4-one.
| Compound Name | 3-(3-fluoro-4-methylphenyl)sulfonyl-6-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 22425158 |
| Molecular Formula | C17H14FNO3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)sulfonyl-6-methyl-1H-quinolin-4-one |
| SMILES | Cc1ccc2[nH]cc(S(=O)(=O)c3ccc(C)c(F)c3)c(=O)c2c1 |
| InChI | InChI=1S/C17H14FNO3S/c1-10-3-6-15-13(7-10)17(20)16(9-19-15)23(21,22)12-5-4-11(2)14(18)8-12/h3-9H,1-2H3,(H,19,20) |
| InChIKey | RWTQSOCIGVOJGG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |