C14H13FO4S — CID 132609514
2-(4-fluorophenyl)sulfonyl-1,4-dimethoxybenzene (PubChem CID 132609514) has the molecular formula C14H13FO4S and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-1,4-dimethoxybenzene.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 132609514 |
| Molecular Formula | C14H13FO4S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H13FO4S/c1-18-11-5-8-13(19-2)14(9-11)20(16,17)12-6-3-10(15)4-7-12/h3-9H,1-2H3 |
| InChIKey | MUDFLEWKQSQXKR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |