C18H17NO4S — CID 2137956
6-ethyl-3-(4-methoxyphenyl)sulfonyl-1H-quinolin-4-one (PubChem CID 2137956) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 6-ethyl-3-(4-methoxyphenyl)sulfonyl-1H-quinolin-4-one.
| Compound Name | 6-ethyl-3-(4-methoxyphenyl)sulfonyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 2137956 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-ethyl-3-(4-methoxyphenyl)sulfonyl-1H-quinolin-4-one |
| SMILES | CCc1ccc2[nH]cc(S(=O)(=O)c3ccc(OC)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C18H17NO4S/c1-3-12-4-9-16-15(10-12)18(20)17(11-19-16)24(21,22)14-7-5-13(23-2)6-8-14/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | LLSVMPFKYUFOEV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |