C18H15N3O3 — CID 23650713
3-(5-methoxy-1H-indol-3-yl)-1-methyl-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione (PubChem CID 23650713) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-(5-methoxy-1H-indol-3-yl)-1-methyl-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-(5-methoxy-1H-indol-3-yl)-1-methyl-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23650713 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-(5-methoxy-1H-indol-3-yl)-1-methyl-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione |
| SMILES | COc1ccc2[nH]cc(C3=C(c4ccc[nH]4)C(=O)N(C)C3=O)c2c1 |
| InChI | InChI=1S/C18H15N3O3/c1-21-17(22)15(16(18(21)23)14-4-3-7-19-14)12-9-20-13-6-5-10(24-2)8-11(12)13/h3-9,19-20H,1-2H3 |
| InChIKey | LRRZVUISLSGCFT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|