C16H11N3O2 — CID 23650558
3-(1H-indol-3-yl)-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione (PubChem CID 23650558) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23650558 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-(1H-pyrrol-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1ccc[nH]1 |
| InChI | InChI=1S/C16H11N3O2/c20-15-13(10-8-18-11-5-2-1-4-9(10)11)14(16(21)19-15)12-6-3-7-17-12/h1-8,17-18H,(H,19,20,21) |
| InChIKey | RWZGYAHVGDKOAU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|