C20H12N2O4 — CID 134998083
3-(1,4-benzodioxin-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 134998083) has the molecular formula C20H12N2O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 3-(1,4-benzodioxin-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1,4-benzodioxin-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134998083 |
| Molecular Formula | C20H12N2O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-(1,4-benzodioxin-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1C1=COc2ccccc2O1 |
| InChI | InChI=1S/C20H12N2O4/c23-19-17(12-9-21-13-6-2-1-5-11(12)13)18(20(24)22-19)16-10-25-14-7-3-4-8-15(14)26-16/h1-10,21H,(H,22,23,24) |
| InChIKey | YYTKJUNJDGEKSM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|