C19H19N3O2 — CID 10639498
3-(cycloheptylideneamino)-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 10639498) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-(cycloheptylideneamino)-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(cycloheptylideneamino)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10639498 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-(cycloheptylideneamino)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1N=C1CCCCCC1 |
| InChI | InChI=1S/C19H19N3O2/c23-18-16(14-11-20-15-10-6-5-9-13(14)15)17(19(24)22-18)21-12-7-3-1-2-4-8-12/h5-6,9-11,20H,1-4,7-8H2,(H,22,23,24) |
| InChIKey | USAMCQFYHPOZJT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|