C18H20N4O3 — CID 141313740
3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 141313740) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141313740 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(N2CCN(CCO)CC2)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20N4O3/c23-10-9-21-5-7-22(8-6-21)16-15(17(24)20-18(16)25)13-11-19-14-4-2-1-3-12(13)14/h1-4,11,19,23H,5-10H2,(H,20,24,25) |
| InChIKey | OHGLJIZLGOUBKP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|