C28H30N2O4 — CID 150684800
3-(1H-indol-3-yl)-4-[3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5,6,7,8-tetrahydronaphthalen-1-yl]pyrrole-2,5-dione (PubChem CID 150684800) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5,6,7,8-tetrahydronaphthalen-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5,6,7,8-tetrahydronaphthalen-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 150684800 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-5,6,7,8-tetrahydronaphthalen-1-yl]pyrrole-2,5-dione |
| SMILES | CC(C)(C)OCCOc1cc2c(c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c1)CCCC2 |
| InChI | InChI=1S/C28H30N2O4/c1-28(2,3)34-13-12-33-18-14-17-8-4-5-9-19(17)21(15-18)24-25(27(32)30-26(24)31)22-16-29-23-11-7-6-10-20(22)23/h6-7,10-11,14-16,29H,4-5,8-9,12-13H2,1-3H3,(H,30,31,32) |
| InChIKey | JIPXZHRCLXQUQK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|