C46H36N6O4 — CID 161315971
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;3-(1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 161315971) has the molecular formula C46H36N6O4 and a molecular weight of 736.83 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;3-(1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;3-(1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 161315971 |
| Molecular Formula | C46H36N6O4 |
| Molecular Weight | 736.83 g/mol |
| Exact Mass | 736.28 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;3-(1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-6-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1cc2c3c(c1)CCN3CCC2.O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1cc2c3c(ccn3CCC2)c1 |
| InChI | InChI=1S/C23H19N3O2.C23H17N3O2/c2*27-22-19(15-10-13-4-3-8-26-9-7-14(11-15)21(13)26)20(23(28)25-22)17-12-24-18-6-2-1-5-16(17)18/h1-2,5-6,10-12,24H,3-4,7-9H2,(H,25,27,28);1-2,5-7,9-12,24H,3-4,8H2,(H,25,27,28) |
| InChIKey | VJMQTKWIYZOGKP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.83 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|