C26H29N3O3 — CID 142139866
3-(3-ethoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;N-methylmethanamine (PubChem CID 142139866) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-(3-ethoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;N-methylmethanamine.
| Compound Name | 3-(3-ethoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;N-methylmethanamine |
|---|---|
| PubChem CID | 142139866 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-(3-ethoxy-5,6,7,8-tetrahydronaphthalen-1-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;N-methylmethanamine |
| SMILES | CCOc1cc2c(c(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c1)CCCC2.CNC |
| InChI | InChI=1S/C24H22N2O3.C2H7N/c1-2-29-15-11-14-7-3-4-8-16(14)18(12-15)21-22(24(28)26-23(21)27)19-13-25-20-10-6-5-9-17(19)20;1-3-2/h5-6,9-13,25H,2-4,7-8H2,1H3,(H,26,27,28);3H,1-2H3 |
| InChIKey | GGLHHWKKRVRBQV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|