C22H15N3O4S — CID 22556849
3-(9,9-dioxo-9λ6-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22556849) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is 3-(9,9-dioxo-9λ6-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(9,9-dioxo-9λ6-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22556849 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-(9,9-dioxo-9λ6-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)S(=O)(=O)CC3)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H15N3O4S/c26-21-18(14-10-23-16-6-2-1-4-12(14)16)19(22(27)24-21)15-11-25-8-9-30(28,29)17-7-3-5-13(15)20(17)25/h1-7,10-11,23H,8-9H2,(H,24,26,27) |
| InChIKey | LVYATUQCBFKPEO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|