C16H19N5O2 — CID 22728646
3-[2-(2-aminoethylamino)ethylamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22728646) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-[2-(2-aminoethylamino)ethylamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-(2-aminoethylamino)ethylamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22728646 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[2-(2-aminoethylamino)ethylamino]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | NCCNCCNC1=C(c2c[nH]c3ccccc23)C(=O)NC1=O |
| InChI | InChI=1S/C16H19N5O2/c17-5-6-18-7-8-19-14-13(15(22)21-16(14)23)11-9-20-12-4-2-1-3-10(11)12/h1-4,9,18,20H,5-8,17H2,(H2,19,21,22,23) |
| InChIKey | VYZMLGLOWDUEEE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|