C19H27N5 — CID 141107236
N-(2-aminoethyl)-N'-[4-(1H-indol-3-yl)-1H-pyrrol-3-yl]pentane-1,5-diamine (PubChem CID 141107236) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[4-(1H-indol-3-yl)-1H-pyrrol-3-yl]pentane-1,5-diamine.
| Compound Name | N-(2-aminoethyl)-N'-[4-(1H-indol-3-yl)-1H-pyrrol-3-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 141107236 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | N-(2-aminoethyl)-N'-[4-(1H-indol-3-yl)-1H-pyrrol-3-yl]pentane-1,5-diamine |
| SMILES | NCCNCCCCCNc1c[nH]cc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H27N5/c20-8-11-21-9-4-1-5-10-23-19-14-22-12-17(19)16-13-24-18-7-3-2-6-15(16)18/h2-3,6-7,12-14,21-24H,1,4-5,8-11,20H2 |
| InChIKey | BPXUDWJTXQWFIX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|