About methane;3-phenyl-1H-indole
methane;3-phenyl-1H-indole (PubChem CID 167711687) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is methane;3-phenyl-1H-indole.
Molecular Properties
| Compound Name | methane;3-phenyl-1H-indole |
| PubChem CID | 167711687 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methane;3-phenyl-1H-indole |
| SMILES | C.c1ccc(-c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C14H11N.CH4/c1-2-6-11(7-3-1)13-10-15-14-9-5-4-8-12(13)14;/h1-10,15H;1H4 |
| InChIKey | ZXYJZJOMQCLWBC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;3-phenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-phenyl-1H-indole?
The IUPAC name of methane;3-phenyl-1H-indole (CID 167711687) is methane;3-phenyl-1H-indole.
What is the SMILES notation for methane;3-phenyl-1H-indole?
The canonical SMILES for methane;3-phenyl-1H-indole is C.c1ccc(-c2c[nH]c3ccccc23)cc1.
What is the InChIKey of methane;3-phenyl-1H-indole?
The InChIKey is ZXYJZJOMQCLWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.CH4/c1-2-6-11(7-3-1)13-10-15-14-9-5-4-8-12(13)14;/h1-10,15H;1H4.
What are the key properties of methane;3-phenyl-1H-indole?
methane;3-phenyl-1H-indole has a molecular weight of 209.29 g/mol, XLogP of 4.47, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-phenyl-1H-indole is sourced from PubChem (CID 167711687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).