C30H20N4O — CID 142621956
3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1H-quinolin-4-one (PubChem CID 142621956) has the molecular formula C30H20N4O and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1H-quinolin-4-one.
| Compound Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 142621956 |
| Molecular Formula | C30H20N4O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1H-quinolin-4-one |
| SMILES | O=c1c(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H20N4O/c35-27-24-13-7-8-14-26(24)31-19-25(27)20-15-17-23(18-16-20)30-33-28(21-9-3-1-4-10-21)32-29(34-30)22-11-5-2-6-12-22/h1-19H,(H,31,35) |
| InChIKey | MJHBZFSMGJRPCB-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |