About 3-pyridin-4-yl-1H-indole
3-pyridin-4-yl-1H-indole (PubChem CID 159430533) has the molecular formula C26H20N4
and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-pyridin-4-yl-1H-indole.
Molecular Properties
| Compound Name | 3-pyridin-4-yl-1H-indole |
| PubChem CID | 159430533 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-pyridin-4-yl-1H-indole |
| SMILES | c1ccc2c(-c3ccncc3)c[nH]c2c1.c1ccc2c(-c3ccncc3)c[nH]c2c1 |
| InChI | InChI=1S/2C13H10N2/c2*1-2-4-13-11(3-1)12(9-15-13)10-5-7-14-8-6-10/h2*1-9,15H |
| InChIKey | LQXSRESCWSLLGA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-pyridin-4-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-yl-1H-indole?
The IUPAC name of 3-pyridin-4-yl-1H-indole (CID 159430533) is 3-pyridin-4-yl-1H-indole.
What is the SMILES notation for 3-pyridin-4-yl-1H-indole?
The canonical SMILES for 3-pyridin-4-yl-1H-indole is c1ccc2c(-c3ccncc3)c[nH]c2c1.c1ccc2c(-c3ccncc3)c[nH]c2c1.
What is the InChIKey of 3-pyridin-4-yl-1H-indole?
The InChIKey is LQXSRESCWSLLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H10N2/c2*1-2-4-13-11(3-1)12(9-15-13)10-5-7-14-8-6-10/h2*1-9,15H.
What are the key properties of 3-pyridin-4-yl-1H-indole?
3-pyridin-4-yl-1H-indole has a molecular weight of 388.47 g/mol, XLogP of 6.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-yl-1H-indole is sourced from PubChem (CID 159430533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).