C32H21N5O — CID 155137996
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2H-pyrido[3,4-b]indol-1-one (PubChem CID 155137996) has the molecular formula C32H21N5O and a molecular weight of 491.55 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 155137996 |
| Molecular Formula | C32H21N5O |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2H-pyrido[3,4-b]indol-1-one |
| SMILES | O=c1[nH]cc(-c2ccccc2)c2c3ccccc3n(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c12 |
| InChI | InChI=1S/C32H21N5O/c38-31-28-27(25(20-33-31)21-12-4-1-5-13-21)24-18-10-11-19-26(24)37(28)32-35-29(22-14-6-2-7-15-22)34-30(36-32)23-16-8-3-9-17-23/h1-20H,(H,33,38) |
| InChIKey | RLOVSZUEVHZJEB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |