C33H27N5O — CID 155694502
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-2H-pyrido[3,4-b]indol-1-one (PubChem CID 155694502) has the molecular formula C33H27N5O and a molecular weight of 509.61 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-2H-pyrido[3,4-b]indol-1-one.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-2H-pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 155694502 |
| Molecular Formula | C33H27N5O |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-2H-pyrido[3,4-b]indol-1-one |
| SMILES | C/C=C\C(=C/CC)c1c[nH]c(=O)c2c1c1ccccc1n2-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H27N5O/c1-3-13-22(14-4-2)26-21-34-32(39)29-28(26)25-19-11-12-20-27(25)38(29)33-36-30(23-15-7-5-8-16-23)35-31(37-33)24-17-9-6-10-18-24/h3,5-21H,4H2,1-2H3,(H,34,39)/b13-3-,22-14+ |
| InChIKey | YDOULPVSPZSBQE-YLNGFTGSSA-N |
| XLogP | 7.36 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|