C19H25N5O2 — CID 91108684
3-[5-(2-aminoethylamino)pentylimino]-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 91108684) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[5-(2-aminoethylamino)pentylimino]-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[5-(2-aminoethylamino)pentylimino]-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91108684 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[5-(2-aminoethylamino)pentylimino]-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | NCCNCCCCC/N=C1\C(=O)NC(=O)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H25N5O2/c20-8-11-21-9-4-1-5-10-22-17-16(18(25)24-19(17)26)14-12-23-15-7-3-2-6-13(14)15/h2-3,6-7,12,16,21,23H,1,4-5,8-11,20H2,(H,24,25,26)/b22-17- |
| InChIKey | QATCMAPBSTXMPG-XLNRJJMWSA-N |
| XLogP | 1.07 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|