C11H8N2O3 — CID 125484827
(5R)-5-(1H-indol-3-yl)-1,3-oxazolidine-2,4-dione (PubChem CID 125484827) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is (5R)-5-(1H-indol-3-yl)-1,3-oxazolidine-2,4-dione.
| Compound Name | (5R)-5-(1H-indol-3-yl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 125484827 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (5R)-5-(1H-indol-3-yl)-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](c2c[nH]c3ccccc23)O1 |
| InChI | InChI=1S/C11H8N2O3/c14-10-9(16-11(15)13-10)7-5-12-8-4-2-1-3-6(7)8/h1-5,9,12H,(H,13,14,15)/t9-/m1/s1 |
| InChIKey | DDWRAUMWZIQKQB-SECBINFHSA-N |
| XLogP | 1.48 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |