C9H7ClN2O5 — CID 162329662
5-(2-nitrophenyl)-1,3-oxazolidine-2,4-dione;hydrochloride (PubChem CID 162329662) has the molecular formula C9H7ClN2O5 and a molecular weight of 258.62 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-1,3-oxazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-(2-nitrophenyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 162329662 |
| Molecular Formula | C9H7ClN2O5 |
| Molecular Weight | 258.62 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 5-(2-nitrophenyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)C(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C9H6N2O5.ClH/c12-8-7(16-9(13)10-8)5-3-1-2-4-6(5)11(14)15;/h1-4,7H,(H,10,12,13);1H |
| InChIKey | YJVPRLJLMRCSNC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|