C12H12N2O4S — CID 3057296
5-ethyl-6-(2-nitrophenyl)-1,3-thiazinane-2,4-dione (PubChem CID 3057296) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 5-ethyl-6-(2-nitrophenyl)-1,3-thiazinane-2,4-dione.
| Compound Name | 5-ethyl-6-(2-nitrophenyl)-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 3057296 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-ethyl-6-(2-nitrophenyl)-1,3-thiazinane-2,4-dione |
| SMILES | CCC1C(=O)NC(=O)SC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O4S/c1-2-7-10(19-12(16)13-11(7)15)8-5-3-4-6-9(8)14(17)18/h3-7,10H,2H2,1H3,(H,13,15,16) |
| InChIKey | DVYGMWQKBXVHQG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|