C17H21N3O6S2 — CID 46211463
N-[(5R,6S)-3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(2-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]acetamide (PubChem CID 46211463) has the molecular formula C17H21N3O6S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[(5R,6S)-3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(2-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]acetamide.
| Compound Name | N-[(5R,6S)-3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(2-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]acetamide |
|---|---|
| PubChem CID | 46211463 |
| Molecular Formula | C17H21N3O6S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-[(5R,6S)-3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(2-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(=O)N(CCC(CO)CO)C(=S)S[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N3O6S2/c1-10(23)18-14-15(12-4-2-3-5-13(12)20(25)26)28-17(27)19(16(14)24)7-6-11(8-21)9-22/h2-5,11,14-15,21-22H,6-9H2,1H3,(H,18,23)/t14-,15-/m0/s1 |
| InChIKey | LFMGTMOYDXECJZ-GJZGRUSLSA-N |
| XLogP | 0.99 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|