C16H11N3O4S — CID 139236773
4-(2-nitrophenyl)-3a,4-dihydro-1H-[1,3]thiazolo[5,4-c][1,5]benzoxazepin-2-one (PubChem CID 139236773) has the molecular formula C16H11N3O4S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-3a,4-dihydro-1H-[1,3]thiazolo[5,4-c][1,5]benzoxazepin-2-one.
| Compound Name | 4-(2-nitrophenyl)-3a,4-dihydro-1H-[1,3]thiazolo[5,4-c][1,5]benzoxazepin-2-one |
|---|---|
| PubChem CID | 139236773 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-(2-nitrophenyl)-3a,4-dihydro-1H-[1,3]thiazolo[5,4-c][1,5]benzoxazepin-2-one |
| SMILES | O=C1NC2=Nc3ccccc3OC(c3ccccc3[N+](=O)[O-])C2S1 |
| InChI | InChI=1S/C16H11N3O4S/c20-16-18-15-14(24-16)13(9-5-1-3-7-11(9)19(21)22)23-12-8-4-2-6-10(12)17-15/h1-8,13-14H,(H,17,18,20) |
| InChIKey | RHRYHGHOXSKRRL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|