C10H10N2O8S — CID 129068463
methyl-[5-(2-nitrophenyl)-2-oxo-1,3-dioxolan-4-yl]sulfamic acid (PubChem CID 129068463) has the molecular formula C10H10N2O8S and a molecular weight of 318.26 g/mol. Its IUPAC name is methyl-[5-(2-nitrophenyl)-2-oxo-1,3-dioxolan-4-yl]sulfamic acid.
| Compound Name | methyl-[5-(2-nitrophenyl)-2-oxo-1,3-dioxolan-4-yl]sulfamic acid |
|---|---|
| PubChem CID | 129068463 |
| Molecular Formula | C10H10N2O8S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | methyl-[5-(2-nitrophenyl)-2-oxo-1,3-dioxolan-4-yl]sulfamic acid |
| SMILES | CN(C1OC(=O)OC1c1ccccc1[N+](=O)[O-])S(=O)(=O)O |
| InChI | InChI=1S/C10H10N2O8S/c1-11(21(16,17)18)9-8(19-10(13)20-9)6-4-2-3-5-7(6)12(14)15/h2-5,8-9H,1H3,(H,16,17,18) |
| InChIKey | SCFSPHSCGBZLGD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|