C10H7NO6 — CID 166773370
2-(2-nitrophenyl)-1,3-dioxane-4,6-dione (PubChem CID 166773370) has the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(2-nitrophenyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 166773370 |
| Molecular Formula | C10H7NO6 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-(2-nitrophenyl)-1,3-dioxane-4,6-dione |
| SMILES | O=C1CC(=O)OC(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C10H7NO6/c12-8-5-9(13)17-10(16-8)6-3-1-2-4-7(6)11(14)15/h1-4,10H,5H2 |
| InChIKey | LAUNTDMELPPAFD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|