C19H14N2O8 — CID 102347578
(5R,7R,9S)-7,9-bis(2-nitrophenyl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one (PubChem CID 102347578) has the molecular formula C19H14N2O8 and a molecular weight of 398.33 g/mol. Its IUPAC name is (5R,7R,9S)-7,9-bis(2-nitrophenyl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one.
| Compound Name | (5R,7R,9S)-7,9-bis(2-nitrophenyl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 102347578 |
| Molecular Formula | C19H14N2O8 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (5R,7R,9S)-7,9-bis(2-nitrophenyl)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1C=C[C@@]2(C[C@H](c3ccccc3[N+](=O)[O-])O[C@H](c3ccccc3[N+](=O)[O-])O2)O1 |
| InChI | InChI=1S/C19H14N2O8/c22-17-9-10-19(28-17)11-16(12-5-1-3-7-14(12)20(23)24)27-18(29-19)13-6-2-4-8-15(13)21(25)26/h1-10,16,18H,11H2/t16-,18+,19-/m1/s1 |
| InChIKey | ALPGUGLSXDHKPR-NZSAHSFTSA-N |
| XLogP | 3.49 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|