About 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione
6-(2-nitrophenyl)-1,3-diazinane-2,4-dione (PubChem CID 3883733) has the molecular formula C10H9N3O4
and a molecular weight of 235.20 g/mol. Its IUPAC name is 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione |
| PubChem CID | 3883733 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CC(c2ccccc2[N+](=O)[O-])NC(=O)N1 |
| InChI | InChI=1S/C10H9N3O4/c14-9-5-7(11-10(15)12-9)6-3-1-2-4-8(6)13(16)17/h1-4,7H,5H2,(H2,11,12,14,15) |
| InChIKey | KHQMKTNFNBJWET-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione?
The IUPAC name of 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione (CID 3883733) is 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione is O=C1CC(c2ccccc2[N+](=O)[O-])NC(=O)N1.
What is the InChIKey of 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione?
The InChIKey is KHQMKTNFNBJWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4/c14-9-5-7(11-10(15)12-9)6-3-1-2-4-8(6)13(16)17/h1-4,7H,5H2,(H2,11,12,14,15).
What are the key properties of 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione?
6-(2-nitrophenyl)-1,3-diazinane-2,4-dione has a molecular weight of 235.20 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-nitrophenyl)-1,3-diazinane-2,4-dione is sourced from PubChem (CID 3883733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).