C12H9N3O3S — CID 7090616
(4S)-4-(2-nitrophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile (PubChem CID 7090616) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is (4S)-4-(2-nitrophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile.
| Compound Name | (4S)-4-(2-nitrophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 7090616 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (4S)-4-(2-nitrophenyl)-2-oxo-6-sulfanyl-3,4-dihydro-1H-pyridine-5-carbonitrile |
| SMILES | N#CC1=C(S)NC(=O)C[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N3O3S/c13-6-9-8(5-11(16)14-12(9)19)7-3-1-2-4-10(7)15(17)18/h1-4,8,19H,5H2,(H,14,16)/t8-/m0/s1 |
| InChIKey | NJMGOOIYUKNCMU-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|