C19H14N4O4 — CID 10737340
4-(2-nitrophenyl)-8-phenyl-1,3,4,6-tetrahydropyrido[2,3-d]pyridazine-2,5-dione (PubChem CID 10737340) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-(2-nitrophenyl)-8-phenyl-1,3,4,6-tetrahydropyrido[2,3-d]pyridazine-2,5-dione.
| Compound Name | 4-(2-nitrophenyl)-8-phenyl-1,3,4,6-tetrahydropyrido[2,3-d]pyridazine-2,5-dione |
|---|---|
| PubChem CID | 10737340 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-(2-nitrophenyl)-8-phenyl-1,3,4,6-tetrahydropyrido[2,3-d]pyridazine-2,5-dione |
| SMILES | O=C1CC(c2ccccc2[N+](=O)[O-])c2c(c(-c3ccccc3)n[nH]c2=O)N1 |
| InChI | InChI=1S/C19H14N4O4/c24-15-10-13(12-8-4-5-9-14(12)23(26)27)16-18(20-15)17(21-22-19(16)25)11-6-2-1-3-7-11/h1-9,13H,10H2,(H,20,24)(H,22,25) |
| InChIKey | QWSBYVXNUUJPQN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|