C19H14N8O4 — CID 137076082
(8R)-10-(4-methoxyphenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076082) has the molecular formula C19H14N8O4 and a molecular weight of 418.37 g/mol. Its IUPAC name is (8R)-10-(4-methoxyphenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-10-(4-methoxyphenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076082 |
| Molecular Formula | C19H14N8O4 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (8R)-10-(4-methoxyphenyl)-8-(2-nitrophenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(-c2n[nH]c(=O)c3c2[C@@H](c2ccccc2[N+](=O)[O-])n2nnnc2N3)cc1 |
| InChI | InChI=1S/C19H14N8O4/c1-31-11-8-6-10(7-9-11)15-14-16(18(28)22-21-15)20-19-23-24-25-26(19)17(14)12-4-2-3-5-13(12)27(29)30/h2-9,17H,1H3,(H,22,28)(H,20,23,25)/t17-/m1/s1 |
| InChIKey | ZUKWPIYSXJSILQ-QGZVFWFLSA-N |
| XLogP | 2.03 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|