C17H13N7O2S — CID 135920784
(8S)-10-(4-methoxyphenyl)-8-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 135920784) has the molecular formula C17H13N7O2S and a molecular weight of 379.41 g/mol. Its IUPAC name is (8S)-10-(4-methoxyphenyl)-8-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8S)-10-(4-methoxyphenyl)-8-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 135920784 |
| Molecular Formula | C17H13N7O2S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (8S)-10-(4-methoxyphenyl)-8-thiophen-2-yl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(-c2n[nH]c(=O)c3c2[C@@H](c2cccs2)n2nnnc2N3)cc1 |
| InChI | InChI=1S/C17H13N7O2S/c1-26-10-6-4-9(5-7-10)13-12-14(16(25)20-19-13)18-17-21-22-23-24(17)15(12)11-3-2-8-27-11/h2-8,15H,1H3,(H,20,25)(H,18,21,23)/t15-/m1/s1 |
| InChIKey | YBWRUJSQGIEUMM-OAHLLOKOSA-N |
| XLogP | 2.19 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |