C20H17N7O4 — CID 137076088
(8R)-8-(4-hydroxy-3-methoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 137076088) has the molecular formula C20H17N7O4 and a molecular weight of 419.40 g/mol. Its IUPAC name is (8R)-8-(4-hydroxy-3-methoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(4-hydroxy-3-methoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 137076088 |
| Molecular Formula | C20H17N7O4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (8R)-8-(4-hydroxy-3-methoxyphenyl)-10-(4-methoxyphenyl)-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | COc1ccc(-c2n[nH]c(=O)c3c2[C@@H](c2ccc(O)c(OC)c2)n2nnnc2N3)cc1 |
| InChI | InChI=1S/C20H17N7O4/c1-30-12-6-3-10(4-7-12)16-15-17(19(29)23-22-16)21-20-24-25-26-27(20)18(15)11-5-8-13(28)14(9-11)31-2/h3-9,18,28H,1-2H3,(H,23,29)(H,21,24,26)/t18-/m1/s1 |
| InChIKey | ZNYHNEZSJLSTRE-GOSISDBHSA-N |
| XLogP | 1.84 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |